| Record Information |
|---|
| Version | 1.0 |
|---|
| Creation date | 2015-10-09 22:33:18 UTC |
|---|
| Update date | 2017-01-19 02:36:40 UTC |
|---|
| FoodComEx ID | PC000902 |
|---|
| FoodDB Record | FDB022434 |
|---|
| Chemical Information |
|---|
| Name | Dimethylallylpyrophosphate |
|---|
| Description | Dimethylallylpyrophosphate, also known as 2-isopentenyl diphosphate or delta-prenyl diphosphoric acid, belongs to the class of organic compounds known as isoprenoid phosphates. These are prenol lipids containing a phosphate group linked to an isoprene (2-methylbuta-1,3-diene) unit. Dimethylallylpyrophosphate is a very hydrophobic molecule, practically insoluble (in water), and relatively neutral. |
|---|
| CAS Number | 358-72-5 |
|---|
| Structure | |
|---|
| Synonyms | | Synonym | Source |
|---|
| 1,1-Dimethyl-4-phenylpiperazinium iodide | hmdb | | 2-Isopentenyl diate | ChEBI | | 2-Isopentenyl diic acid | Generator | | 2-Isopentenyl diphosphate | hmdb | | 3-Methyl-2-buten-1-ol pyroate | HMDB | | 3-methyl-2-Buten-1-ol pyrophosphate | hmdb | | 3-Methyl-2-buten-1-ol trihydrogen pyroate | HMDB | | 3-methyl-2-Buten-1-ol trihydrogen pyrophosphate | hmdb | | 3-Methyl-2-butenyl pyroate | HMDB | | 3-Methyl-2-butenyl pyrophosphate | hmdb | | 3-Methylbut-2-enyl ONO hydrogen ate | ChEBI | | 3-Methylbut-2-enyl ONO hydrogen ic acid | Generator | | 3-Methylbut-2-enyl pyroate | HMDB | | 3-methylbut-2-enyl pyrophosphate | hmdb | | 3,3-Dimethylallyl pyroate | ChEBI | | 3,3-Dimethylallyl pyroic acid | Generator | | 3,3-Dimethylallyl pyrophosphate | hmdb | | delta-Prenyl diate | ChEBI | | delta-Prenyl diic acid | Generator | | delta-Prenyl diphosphate | hmdb | | delta2-Isopentenyl diate | ChEBI | | delta2-Isopentenyl diic acid | Generator | | delta2-Isopentenyl diphosphate | hmdb | | Delta2-Isopentenyl-diate | HMDB | | delta2-isopentenyl-diphosphate | hmdb | | Dimethylallyl diate | ChEBI | | Dimethylallyl diic acid | Generator | | Dimethylallyl diphosphate | hmdb | | Dimethylallyl pyroate | ChEBI | | Dimethylallyl pyroic acid | Generator | | dimethylallyl pyrophosphate | hmdb | | Dimethylallyl-diate | HMDB | | dimethylallyl-diphosphate | hmdb | | dimethylallyl-PP | hmdb | | dimethylallyl-PPi | hmdb | | Dimethylallyl-pyroate | HMDB | | dimethylallyl-pyrophosphate | hmdb | | Dimethylallylpyroate | HMDB | | Dimethylallylpyrophosphate | hmdb | | Dimethylallylpyrophosphic acid | hmdb | | Dioric acid mono(3-methyl-2-butenyl) ester | HMDB | | Diphosphoric acid mono(3-methyl-2-butenyl) ester | hmdb | | DMAPP | hmdb | | DMPP | hmdb | | IPE | hmdb | | Monoprenyl diate | ChEBI | | Monoprenyl diic acid | Generator | | Prenol pyroate | ChEBI | | Prenol pyroic acid | Generator | | Prenyl diate | ChEBI | | Prenyl diic acid | Generator | | Prenyl diphosphate | hmdb | | Prenyl-diate | HMDB | | prenyl-diphosphate | hmdb | | δ-prenyl diate | Generator | | δ-prenyl diic acid | Generator | | δ2-isopentenyl diate | Generator | | δ2-isopentenyl diic acid | Generator |
|
|---|
| Chemical Formula | C5H12O7P2 |
|---|
| IUPAC name | ({hydroxy[(3-methylbut-2-en-1-yl)oxy]phosphoryl}oxy)phosphonic acid |
|---|
| InChI Identifier | InChI=1S/C5H12O7P2/c1-5(2)3-4-11-14(9,10)12-13(6,7)8/h3H,4H2,1-2H3,(H,9,10)(H2,6,7,8) |
|---|
| InChI Key | CBIDRCWHNCKSTO-UHFFFAOYSA-N |
|---|
| Isomeric SMILES | CC(C)=CCO[P@](O)(=O)OP(O)(O)=O |
|---|
| Average Molecular Weight | 246.0921 |
|---|
| Monoisotopic Molecular Weight | 246.005825762 |
|---|
| Chemical Taxonomy |
|---|
| Description | Belongs to the class of organic compounds known as isoprenoid phosphates. These are prenol lipids containing a phosphate group linked to an isoprene (2-methylbuta-1,3-diene) unit. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Lipids and lipid-like molecules |
|---|
| Class | Prenol lipids |
|---|
| Sub Class | Isoprenoid phosphates |
|---|
| Direct Parent | Isoprenoid phosphates |
|---|
| Alternative Parents | |
|---|
| Substituents | - Organic pyrophosphate
- Isoprenoid phosphate
- Monoalkyl phosphate
- Alkyl phosphate
- Phosphoric acid ester
- Organic phosphoric acid derivative
- Organic oxygen compound
- Organic oxide
- Hydrocarbon derivative
- Organooxygen compound
- Aliphatic acyclic compound
|
|---|
| Molecular Framework | Aliphatic acyclic compounds |
|---|
| External Descriptors | |
|---|
| Physico-Chemical Properties - Experimental |
|---|
| Property | Value | Reference |
|---|
| Experimental logP | Not Available | |
|---|
| Experimental Water Solubility | Not Available | |
|---|
| Melting Point | Not Available | |
|---|
|
| Foods of Origin |
|---|
| Food | Content Range | Average | Reference |
|---|
| Food | | | Reference |
|---|
|
| Production Data |
|---|
| Production Method | commercial |
|---|
| Production Method Reference | Not Available |
|---|
| Production Method Reference File | Not Available |
|---|
| Quantity Available | Production upon request, up to 2 mg |
|---|
| Delivery Time | Not Available |
|---|
| Storage Form | solid |
|---|
| Storage Conditions | -80°C |
|---|
| Stability | Not Available |
|---|
| Purity | Not Available |
|---|
| Spectra |
|---|
| Spectral Data Upon Request | Not Available |
|---|
| Provider Information |
|---|
|
| Commercial Vendors |
|---|
| Not Available |
